C25H33N2NaO7S3 — CID 23666189
sodium 4-[8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxo-3-sulfanyloctyl]sulfanyl-4-oxobutanoate (PubChem CID 23666189) has the molecular formula C25H33N2NaO7S3 and a molecular weight of 592.74 g/mol. Its IUPAC name is sodium 4-[8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxo-3-sulfanyloctyl]sulfanyl-4-oxobutanoate.
| Compound Name | sodium 4-[8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxo-3-sulfanyloctyl]sulfanyl-4-oxobutanoate |
|---|---|
| PubChem CID | 23666189 |
| Molecular Formula | C25H33N2NaO7S3 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | sodium 4-[8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxo-3-sulfanyloctyl]sulfanyl-4-oxobutanoate |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)C(=O)CCCCC(S)CCSC(=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C25H34N2O7S3.Na/c1-27(21(28)5-3-2-4-19(35)12-15-36-23(31)11-10-22(29)30)13-14-34-18-8-6-17(7-9-18)16-20-24(32)26-25(33)37-20;/h6-9,19-20,35H,2-5,10-16H2,1H3,(H,29,30)(H,26,32,33);/q;+1/p-1 |
| InChIKey | ZFJFXLALQKYJRC-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|