C9H7NaO3S — CID 23666256
sodium 3-phenylpropa-1,2-diene-1-sulfonate (PubChem CID 23666256) has the molecular formula C9H7NaO3S and a molecular weight of 218.21 g/mol. Its IUPAC name is sodium 3-phenylpropa-1,2-diene-1-sulfonate.
| Compound Name | sodium 3-phenylpropa-1,2-diene-1-sulfonate |
|---|---|
| PubChem CID | 23666256 |
| Molecular Formula | C9H7NaO3S |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | sodium 3-phenylpropa-1,2-diene-1-sulfonate |
| SMILES | O=S(=O)([O-])C=C=Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C9H8O3S.Na/c10-13(11,12)8-4-7-9-5-2-1-3-6-9;/h1-3,5-8H,(H,10,11,12);/q;+1/p-1 |
| InChIKey | QSHOOBOVUONRGU-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|