About potassium 12-hydroxyoctadecanoate
potassium 12-hydroxyoctadecanoate (PubChem CID 23666670) has the molecular formula C18H35KO3
and a molecular weight of 338.57 g/mol. Its IUPAC name is potassium 12-hydroxyoctadecanoate.
Molecular Properties
| Compound Name | potassium 12-hydroxyoctadecanoate |
| PubChem CID | 23666670 |
| Molecular Formula | C18H35KO3 |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | potassium 12-hydroxyoctadecanoate |
| SMILES | CCCCCCC(O)CCCCCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C18H36O3.K/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h17,19H,2-16H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | IFQCEOKSFPQHTD-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 12-hydroxyoctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 12-hydroxyoctadecanoate?
The IUPAC name of potassium 12-hydroxyoctadecanoate (CID 23666670) is potassium 12-hydroxyoctadecanoate.
What is the SMILES notation for potassium 12-hydroxyoctadecanoate?
The canonical SMILES for potassium 12-hydroxyoctadecanoate is CCCCCCC(O)CCCCCCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium 12-hydroxyoctadecanoate?
The InChIKey is IFQCEOKSFPQHTD-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O3.K/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h17,19H,2-16H2,1H3,(H,20,21);/q;+1/p-1.
What are the key properties of potassium 12-hydroxyoctadecanoate?
potassium 12-hydroxyoctadecanoate has a molecular weight of 338.57 g/mol, XLogP of 0.97, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 12-hydroxyoctadecanoate is sourced from PubChem (CID 23666670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).