About sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate
sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 23666913) has the molecular formula C11H17NaO3
and a molecular weight of 220.24 g/mol. Its IUPAC name is sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 23666913 |
| Molecular Formula | C11H17NaO3 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC12CCC(C(=O)[O-])(CC1O)C2(C)C.[Na+] |
| InChI | InChI=1S/C11H18O3.Na/c1-9(2)10(3)4-5-11(9,8(13)14)6-7(10)12;/h7,12H,4-6H2,1-3H3,(H,13,14);/q;+1/p-1 |
| InChIKey | WMKNDHRVWFUUKP-UHFFFAOYSA-M |
| XLogP | -2.68 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (CID 23666913) is sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate is CC12CCC(C(=O)[O-])(CC1O)C2(C)C.[Na+].
What is the InChIKey of sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is WMKNDHRVWFUUKP-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H18O3.Na/c1-9(2)10(3)4-5-11(9,8(13)14)6-7(10)12;/h7,12H,4-6H2,1-3H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 220.24 g/mol, XLogP of -2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 23666913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).