About sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate
sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 23666917) has the molecular formula C11H16NNaO3
and a molecular weight of 233.24 g/mol. Its IUPAC name is sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 23666917 |
| Molecular Formula | C11H16NNaO3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC12CCC(C(=O)[O-])(CC1=NO)C2(C)C.[Na+] |
| InChI | InChI=1S/C11H17NO3.Na/c1-9(2)10(3)4-5-11(9,8(13)14)6-7(10)12-15;/h15H,4-6H2,1-3H3,(H,13,14);/q;+1/p-1 |
| InChIKey | URPLEHCYPUASQA-UHFFFAOYSA-M |
| XLogP | -2.21 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (CID 23666917) is sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate is CC12CCC(C(=O)[O-])(CC1=NO)C2(C)C.[Na+].
What is the InChIKey of sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is URPLEHCYPUASQA-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H17NO3.Na/c1-9(2)10(3)4-5-11(9,8(13)14)6-7(10)12-15;/h15H,4-6H2,1-3H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 233.24 g/mol, XLogP of -2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 23666917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).