About lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate
lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate (PubChem CID 23666953) has the molecular formula C13H12LiN3O5
and a molecular weight of 297.20 g/mol. Its IUPAC name is lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate |
| PubChem CID | 23666953 |
| Molecular Formula | C13H12LiN3O5 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate |
| SMILES | COc1cc(OC)nc(C(O)c2cccnc2C(=O)[O-])n1.[Li+] |
| InChI | InChI=1S/C13H13N3O5.Li/c1-20-8-6-9(21-2)16-12(15-8)11(17)7-4-3-5-14-10(7)13(18)19;/h3-6,11,17H,1-2H3,(H,18,19);/q;+1/p-1 |
| InChIKey | IJKNWWUOIWHPIK-UHFFFAOYSA-M |
| XLogP | -3.66 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate?
The IUPAC name of lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate (CID 23666953) is lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate.
What is the SMILES notation for lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate?
The canonical SMILES for lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate is COc1cc(OC)nc(C(O)c2cccnc2C(=O)[O-])n1.[Li+].
What is the InChIKey of lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate?
The InChIKey is IJKNWWUOIWHPIK-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H13N3O5.Li/c1-20-8-6-9(21-2)16-12(15-8)11(17)7-4-3-5-14-10(7)13(18)19;/h3-6,11,17H,1-2H3,(H,18,19);/q;+1/p-1.
What are the key properties of lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate?
lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate has a molecular weight of 297.20 g/mol, XLogP of -3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]pyridine-2-carboxylate is sourced from PubChem (CID 23666953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).