About sodium;1-methylpiperazine;carbamodithioate
sodium;1-methylpiperazine;carbamodithioate (PubChem CID 23667321) has the molecular formula C6H14N3NaS2
and a molecular weight of 215.32 g/mol. Its IUPAC name is sodium;1-methylpiperazine;carbamodithioate.
Molecular Properties
| Compound Name | sodium;1-methylpiperazine;carbamodithioate |
| PubChem CID | 23667321 |
| Molecular Formula | C6H14N3NaS2 |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | sodium;1-methylpiperazine;carbamodithioate |
| SMILES | CN1CCNCC1.NC(=S)[S-].[Na+] |
| InChI | InChI=1S/C5H12N2.CH3NS2.Na/c1-7-4-2-6-3-5-7;2-1(3)4;/h6H,2-5H2,1H3;(H3,2,3,4);/q;;+1/p-1 |
| InChIKey | SPDAJEACYISTMH-UHFFFAOYSA-M |
| XLogP | -3.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-methylpiperazine;carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-methylpiperazine;carbamodithioate?
The IUPAC name of sodium;1-methylpiperazine;carbamodithioate (CID 23667321) is sodium;1-methylpiperazine;carbamodithioate.
What is the SMILES notation for sodium;1-methylpiperazine;carbamodithioate?
The canonical SMILES for sodium;1-methylpiperazine;carbamodithioate is CN1CCNCC1.NC(=S)[S-].[Na+].
What is the InChIKey of sodium;1-methylpiperazine;carbamodithioate?
The InChIKey is SPDAJEACYISTMH-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12N2.CH3NS2.Na/c1-7-4-2-6-3-5-7;2-1(3)4;/h6H,2-5H2,1H3;(H3,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;1-methylpiperazine;carbamodithioate?
sodium;1-methylpiperazine;carbamodithioate has a molecular weight of 215.32 g/mol, XLogP of -3.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-methylpiperazine;carbamodithioate is sourced from PubChem (CID 23667321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).