About sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate
sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate (PubChem CID 23667353) has the molecular formula C14H7NaO7S
and a molecular weight of 342.26 g/mol. Its IUPAC name is sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate.
Molecular Properties
| Compound Name | sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| PubChem CID | 23667353 |
| Molecular Formula | C14H7NaO7S |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(S(=O)(=O)[O-])cc(O)c21.[Na+] |
| InChI | InChI=1S/C14H8O7S.Na/c15-8-5-9(22(19,20)21)14(18)11-10(8)12(16)6-3-1-2-4-7(6)13(11)17;/h1-5,15,18H,(H,19,20,21);/q;+1/p-1 |
| InChIKey | UCUKLRSMQAODEF-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate?
The IUPAC name of sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate (CID 23667353) is sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate.
What is the SMILES notation for sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate?
The canonical SMILES for sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate is O=C1c2ccccc2C(=O)c2c(O)c(S(=O)(=O)[O-])cc(O)c21.[Na+].
What is the InChIKey of sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate?
The InChIKey is UCUKLRSMQAODEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H8O7S.Na/c15-8-5-9(22(19,20)21)14(18)11-10(8)12(16)6-3-1-2-4-7(6)13(11)17;/h1-5,15,18H,(H,19,20,21);/q;+1/p-1.
What are the key properties of sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate?
sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate has a molecular weight of 342.26 g/mol, XLogP of -2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate is sourced from PubChem (CID 23667353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).