About dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate
dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate (PubChem CID 23667511) has the molecular formula C8H4Li2N2O2
and a molecular weight of 174.01 g/mol. Its IUPAC name is dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate.
Molecular Properties
| Compound Name | dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate |
| PubChem CID | 23667511 |
| Molecular Formula | C8H4Li2N2O2 |
| Molecular Weight | 174.01 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate |
| SMILES | O=C([O-])n1[c-]cc2cccnc21.[Li+].[Li+] |
| InChI | InChI=1S/C8H5N2O2.2Li/c11-8(12)10-5-3-6-2-1-4-9-7(6)10;;/h1-4H,(H,11,12);;/q-1;2*+1/p-1 |
| InChIKey | IYFCHIMFVJZBIG-UHFFFAOYSA-M |
| XLogP | -5.96 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.01 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate?
The IUPAC name of dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate (CID 23667511) is dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate.
What is the SMILES notation for dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate?
The canonical SMILES for dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate is O=C([O-])n1[c-]cc2cccnc21.[Li+].[Li+].
What is the InChIKey of dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate?
The InChIKey is IYFCHIMFVJZBIG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H5N2O2.2Li/c11-8(12)10-5-3-6-2-1-4-9-7(6)10;;/h1-4H,(H,11,12);;/q-1;2*+1/p-1.
What are the key properties of dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate?
dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate has a molecular weight of 174.01 g/mol, XLogP of -5.96, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2H-pyrrolo[2,3-b]pyridin-2-ide-1-carboxylate is sourced from PubChem (CID 23667511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).