sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione

C10H15N2NaO3 — CID 23667658

IUPACsodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione
SMILESCCN1C(=O)[N-]C(=O)C(CC)(CC)C1=O.[Na+]
InChIInChI=1S/C10H16N2O3.Na/c1-4-10(5-2)7(13)11-9(15)12(6-3)8(10)14;/h4-6H2,1-3H3,(H,11,13,15);/q;+1/p-1
InChIKeyYJMIMZCVYFWXAC-UHFFFAOYSA-M
MW234.23 g/mol
LogP-1.32
Rot. Bonds3

About sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione

sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione (PubChem CID 23667658) has the molecular formula C10H15N2NaO3 and a molecular weight of 234.23 g/mol. Its IUPAC name is sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione.

Molecular Properties

Compound Namesodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione
PubChem CID23667658
Molecular FormulaC10H15N2NaO3
Molecular Weight234.23 g/mol
Exact Mass234.10
IUPAC Namesodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione
SMILESCCN1C(=O)[N-]C(=O)C(CC)(CC)C1=O.[Na+]
InChIInChI=1S/C10H16N2O3.Na/c1-4-10(5-2)7(13)11-9(15)12(6-3)8(10)14;/h4-6H2,1-3H3,(H,11,13,15);/q;+1/p-1
InChIKeyYJMIMZCVYFWXAC-UHFFFAOYSA-M
XLogP-1.32
TPSA68.55 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.23
LogP ≤ 5-1.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione?
The IUPAC name of sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione (CID 23667658) is sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione.
What is the SMILES notation for sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione?
The canonical SMILES for sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione is CCN1C(=O)[N-]C(=O)C(CC)(CC)C1=O.[Na+].
What is the InChIKey of sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione?
The InChIKey is YJMIMZCVYFWXAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N2O3.Na/c1-4-10(5-2)7(13)11-9(15)12(6-3)8(10)14;/h4-6H2,1-3H3,(H,11,13,15);/q;+1/p-1.
What are the key properties of sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione?
sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione has a molecular weight of 234.23 g/mol, XLogP of -1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,5,5-triethylpyrimidin-3-ide-2,4,6-trione is sourced from PubChem (CID 23667658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).