About potassium phenanthrene-3-sulfonate
potassium phenanthrene-3-sulfonate (PubChem CID 23667941) has the molecular formula C14H9KO3S
and a molecular weight of 296.39 g/mol. Its IUPAC name is potassium phenanthrene-3-sulfonate.
Molecular Properties
| Compound Name | potassium phenanthrene-3-sulfonate |
| PubChem CID | 23667941 |
| Molecular Formula | C14H9KO3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | potassium phenanthrene-3-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2ccc3ccccc3c2c1.[K+] |
| InChI | InChI=1S/C14H10O3S.K/c15-18(16,17)12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12;/h1-9H,(H,15,16,17);/q;+1/p-1 |
| InChIKey | SUINDDWAZFAEFB-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium phenanthrene-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium phenanthrene-3-sulfonate?
The IUPAC name of potassium phenanthrene-3-sulfonate (CID 23667941) is potassium phenanthrene-3-sulfonate.
What is the SMILES notation for potassium phenanthrene-3-sulfonate?
The canonical SMILES for potassium phenanthrene-3-sulfonate is O=S(=O)([O-])c1ccc2ccc3ccccc3c2c1.[K+].
What is the InChIKey of potassium phenanthrene-3-sulfonate?
The InChIKey is SUINDDWAZFAEFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H10O3S.K/c15-18(16,17)12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12;/h1-9H,(H,15,16,17);/q;+1/p-1.
What are the key properties of potassium phenanthrene-3-sulfonate?
potassium phenanthrene-3-sulfonate has a molecular weight of 296.39 g/mol, XLogP of -0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium phenanthrene-3-sulfonate is sourced from PubChem (CID 23667941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).