C6F12LiNO4S — CID 23668080
lithium 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate (PubChem CID 23668080) has the molecular formula C6F12LiNO4S and a molecular weight of 417.05 g/mol. Its IUPAC name is lithium 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate.
| Compound Name | lithium 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate |
|---|---|
| PubChem CID | 23668080 |
| Molecular Formula | C6F12LiNO4S |
| Molecular Weight | 417.05 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | lithium 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F.[Li+] |
| InChI | InChI=1S/C6HF12NO4S.Li/c7-1(8)4(13,14)23-5(15,16)2(9,10)19(1)3(11,12)6(17,18)24(20,21)22;/h(H,20,21,22);/q;+1/p-1 |
| InChIKey | SAJGJABIOJGLTO-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.05 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|