sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate

C2ClF4NaO3S — CID 23668359

IUPACsodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate
SMILESO=S(=O)([O-])C(F)(F)C(F)(F)Cl.[Na+]
InChIInChI=1S/C2HClF4O3S.Na/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1
InChIKeyYOJQBKWNQDCPSN-UHFFFAOYSA-M
MW238.52 g/mol
LogP-2.04
Rot. Bonds2

About sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate

sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 23668359) has the molecular formula C2ClF4NaO3S and a molecular weight of 238.52 g/mol. Its IUPAC name is sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate.

Molecular Properties

Compound Namesodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate
PubChem CID23668359
Molecular FormulaC2ClF4NaO3S
Molecular Weight238.52 g/mol
Exact Mass237.91
IUPAC Namesodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate
SMILESO=S(=O)([O-])C(F)(F)C(F)(F)Cl.[Na+]
InChIInChI=1S/C2HClF4O3S.Na/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1
InChIKeyYOJQBKWNQDCPSN-UHFFFAOYSA-M
XLogP-2.04
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.52
LogP ≤ 5-2.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate?
The IUPAC name of sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate (CID 23668359) is sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate.
What is the SMILES notation for sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate?
The canonical SMILES for sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate is O=S(=O)([O-])C(F)(F)C(F)(F)Cl.[Na+].
What is the InChIKey of sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate?
The InChIKey is YOJQBKWNQDCPSN-UHFFFAOYSA-M. The full InChI is InChI=1S/C2HClF4O3S.Na/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate?
sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate has a molecular weight of 238.52 g/mol, XLogP of -2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-chloro-1,1,2,2-tetrafluoroethanesulfonate is sourced from PubChem (CID 23668359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).