C22H41NaO7S — CID 23668811
sodium 1,4-bis(2,6-dimethylheptoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 23668811) has the molecular formula C22H41NaO7S and a molecular weight of 472.62 g/mol. Its IUPAC name is sodium 1,4-bis(2,6-dimethylheptoxy)-1,4-dioxobutane-2-sulfonate.
| Compound Name | sodium 1,4-bis(2,6-dimethylheptoxy)-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 23668811 |
| Molecular Formula | C22H41NaO7S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | sodium 1,4-bis(2,6-dimethylheptoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CC(C)CCCC(C)COC(=O)CC(C(=O)OCC(C)CCCC(C)C)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H42O7S.Na/c1-16(2)9-7-11-18(5)14-28-21(23)13-20(30(25,26)27)22(24)29-15-19(6)12-8-10-17(3)4;/h16-20H,7-15H2,1-6H3,(H,25,26,27);/q;+1/p-1 |
| InChIKey | VKDIBUUSCYWJOQ-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|