About sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate
sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate (PubChem CID 23668976) has the molecular formula C24H15FNNaO2
and a molecular weight of 391.38 g/mol. Its IUPAC name is sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate.
Molecular Properties
| Compound Name | sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate |
| PubChem CID | 23668976 |
| Molecular Formula | C24H15FNNaO2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate |
| SMILES | O=C([O-])c1c2c(nc3ccc(F)cc13)-c1ccc(-c3ccccc3)cc1CC2.[Na+] |
| InChI | InChI=1S/C24H16FNO2.Na/c25-17-8-11-21-20(13-17)22(24(27)28)19-10-7-16-12-15(14-4-2-1-3-5-14)6-9-18(16)23(19)26-21;/h1-6,8-9,11-13H,7,10H2,(H,27,28);/q;+1/p-1 |
| InChIKey | IWWHYKOTAAICBZ-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate?
The IUPAC name of sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate (CID 23668976) is sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate.
What is the SMILES notation for sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate?
The canonical SMILES for sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate is O=C([O-])c1c2c(nc3ccc(F)cc13)-c1ccc(-c3ccccc3)cc1CC2.[Na+].
What is the InChIKey of sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate?
The InChIKey is IWWHYKOTAAICBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H16FNO2.Na/c25-17-8-11-21-20(13-17)22(24(27)28)19-10-7-16-12-15(14-4-2-1-3-5-14)6-9-18(16)23(19)26-21;/h1-6,8-9,11-13H,7,10H2,(H,27,28);/q;+1/p-1.
What are the key properties of sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate?
sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate has a molecular weight of 391.38 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 9-fluoro-3-phenyl-5,6-dihydrobenzo[c]acridine-7-carboxylate is sourced from PubChem (CID 23668976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).