About sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate
sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate (PubChem CID 23669604) has the molecular formula C21H17N2NaO3S
and a molecular weight of 400.44 g/mol. Its IUPAC name is sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate.
Molecular Properties
| Compound Name | sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate |
| PubChem CID | 23669604 |
| Molecular Formula | C21H17N2NaO3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C21H18N2O3S.Na/c24-27(25,26)19-13-11-18(12-14-19)23-21(17-9-5-2-6-10-17)15-20(22-23)16-7-3-1-4-8-16;/h1-14,21H,15H2,(H,24,25,26);/q;+1/p-1 |
| InChIKey | PQYYIQJGKUGBAV-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate?
The IUPAC name of sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate (CID 23669604) is sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate.
What is the SMILES notation for sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate?
The canonical SMILES for sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate is O=S(=O)([O-])c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1.[Na+].
What is the InChIKey of sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate?
The InChIKey is PQYYIQJGKUGBAV-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H18N2O3S.Na/c24-27(25,26)19-13-11-18(12-14-19)23-21(17-9-5-2-6-10-17)15-20(22-23)16-7-3-1-4-8-16;/h1-14,21H,15H2,(H,24,25,26);/q;+1/p-1.
What are the key properties of sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate?
sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate has a molecular weight of 400.44 g/mol, XLogP of 0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonate is sourced from PubChem (CID 23669604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).