About potassium 2-ethylhexanoate
potassium 2-ethylhexanoate (PubChem CID 23669619) has the molecular formula C8H15KO2
and a molecular weight of 182.30 g/mol. Its IUPAC name is potassium 2-ethylhexanoate.
Molecular Properties
| Compound Name | potassium 2-ethylhexanoate |
| PubChem CID | 23669619 |
| Molecular Formula | C8H15KO2 |
| Molecular Weight | 182.30 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | potassium 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)[O-].[K+] |
| InChI | InChI=1S/C8H16O2.K/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | ZUFQCVZBBNZMKD-UHFFFAOYSA-M |
| XLogP | -2.04 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.30 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-ethylhexanoate?
The IUPAC name of potassium 2-ethylhexanoate (CID 23669619) is potassium 2-ethylhexanoate.
What is the SMILES notation for potassium 2-ethylhexanoate?
The canonical SMILES for potassium 2-ethylhexanoate is CCCCC(CC)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-ethylhexanoate?
The InChIKey is ZUFQCVZBBNZMKD-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.K/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1.
What are the key properties of potassium 2-ethylhexanoate?
potassium 2-ethylhexanoate has a molecular weight of 182.30 g/mol, XLogP of -2.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-ethylhexanoate is sourced from PubChem (CID 23669619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).