About sodium 3-aminophenolate
sodium 3-aminophenolate (PubChem CID 23669774) has the molecular formula C6H6NNaO
and a molecular weight of 131.11 g/mol. Its IUPAC name is sodium 3-aminophenolate.
Molecular Properties
| Compound Name | sodium 3-aminophenolate |
| PubChem CID | 23669774 |
| Molecular Formula | C6H6NNaO |
| Molecular Weight | 131.11 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | sodium 3-aminophenolate |
| SMILES | Nc1cccc([O-])c1.[Na+] |
| InChI | InChI=1S/C6H7NO.Na/c7-5-2-1-3-6(8)4-5;/h1-4,8H,7H2;/q;+1/p-1 |
| InChIKey | VLDROEPDJWRSGR-UHFFFAOYSA-M |
| XLogP | -2.65 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.11 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-aminophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-aminophenolate?
The IUPAC name of sodium 3-aminophenolate (CID 23669774) is sodium 3-aminophenolate.
What is the SMILES notation for sodium 3-aminophenolate?
The canonical SMILES for sodium 3-aminophenolate is Nc1cccc([O-])c1.[Na+].
What is the InChIKey of sodium 3-aminophenolate?
The InChIKey is VLDROEPDJWRSGR-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO.Na/c7-5-2-1-3-6(8)4-5;/h1-4,8H,7H2;/q;+1/p-1.
What are the key properties of sodium 3-aminophenolate?
sodium 3-aminophenolate has a molecular weight of 131.11 g/mol, XLogP of -2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-aminophenolate is sourced from PubChem (CID 23669774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).