About sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate
sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate (PubChem CID 23670013) has the molecular formula C19H12NaO5PS
and a molecular weight of 406.33 g/mol. Its IUPAC name is sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate.
Molecular Properties
| Compound Name | sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate |
| PubChem CID | 23670013 |
| Molecular Formula | C19H12NaO5PS |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate |
| SMILES | O=C(OP(=O)([O-])Oc1ccc2ccccc2c1)c1cc2ccccc2s1.[Na+] |
| InChI | InChI=1S/C19H13O5PS.Na/c20-19(18-12-15-7-3-4-8-17(15)26-18)24-25(21,22)23-16-10-9-13-5-1-2-6-14(13)11-16;/h1-12H,(H,21,22);/q;+1/p-1 |
| InChIKey | XJTVASXPQZUZQB-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate?
The IUPAC name of sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate (CID 23670013) is sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate.
What is the SMILES notation for sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate?
The canonical SMILES for sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate is O=C(OP(=O)([O-])Oc1ccc2ccccc2c1)c1cc2ccccc2s1.[Na+].
What is the InChIKey of sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate?
The InChIKey is XJTVASXPQZUZQB-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H13O5PS.Na/c20-19(18-12-15-7-3-4-8-17(15)26-18)24-25(21,22)23-16-10-9-13-5-1-2-6-14(13)11-16;/h1-12H,(H,21,22);/q;+1/p-1.
What are the key properties of sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate?
sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate has a molecular weight of 406.33 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-benzothiophene-2-carbonyl naphthalen-2-yl phosphate is sourced from PubChem (CID 23670013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).