About sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate
sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate (PubChem CID 23670204) has the molecular formula C13H23N2NaO2S
and a molecular weight of 294.40 g/mol. Its IUPAC name is sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate.
Molecular Properties
| Compound Name | sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate |
| PubChem CID | 23670204 |
| Molecular Formula | C13H23N2NaO2S |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate |
| SMILES | CCCCN(CCCC)C1CN=C(CC(=O)[O-])S1.[Na+] |
| InChI | InChI=1S/C13H24N2O2S.Na/c1-3-5-7-15(8-6-4-2)12-10-14-11(18-12)9-13(16)17;/h12H,3-10H2,1-2H3,(H,16,17);/q;+1/p-1 |
| InChIKey | GXARFHVKNSCPGO-UHFFFAOYSA-M |
| XLogP | -1.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate?
The IUPAC name of sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate (CID 23670204) is sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate.
What is the SMILES notation for sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate?
The canonical SMILES for sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate is CCCCN(CCCC)C1CN=C(CC(=O)[O-])S1.[Na+].
What is the InChIKey of sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate?
The InChIKey is GXARFHVKNSCPGO-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H24N2O2S.Na/c1-3-5-7-15(8-6-4-2)12-10-14-11(18-12)9-13(16)17;/h12H,3-10H2,1-2H3,(H,16,17);/q;+1/p-1.
What are the key properties of sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate?
sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate has a molecular weight of 294.40 g/mol, XLogP of -1.50, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[5-(dibutylamino)-4,5-dihydro-1,3-thiazol-2-yl]acetate is sourced from PubChem (CID 23670204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).