About sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate
sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate (PubChem CID 23670237) has the molecular formula C4HF3NNaO2
and a molecular weight of 175.04 g/mol. Its IUPAC name is sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate.
Molecular Properties
| Compound Name | sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate |
| PubChem CID | 23670237 |
| Molecular Formula | C4HF3NNaO2 |
| Molecular Weight | 175.04 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate |
| SMILES | [Na+].[O-]c1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C4H2F3NO2.Na/c5-4(6,7)2-1-3(9)10-8-2;/h1,9H;/q;+1/p-1 |
| InChIKey | JFVMMNGOEMWKRS-UHFFFAOYSA-M |
| XLogP | -2.23 |
| TPSA | 49.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.04 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate?
The IUPAC name of sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate (CID 23670237) is sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate.
What is the SMILES notation for sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate?
The canonical SMILES for sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate is [Na+].[O-]c1cc(C(F)(F)F)no1.
What is the InChIKey of sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate?
The InChIKey is JFVMMNGOEMWKRS-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H2F3NO2.Na/c5-4(6,7)2-1-3(9)10-8-2;/h1,9H;/q;+1/p-1.
What are the key properties of sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate?
sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate has a molecular weight of 175.04 g/mol, XLogP of -2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(trifluoromethyl)-1,2-oxazol-5-olate is sourced from PubChem (CID 23670237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).