C13H12F3NaO2 — CID 23670626
sodium (Z)-1,1,1-trifluoro-4-oxo-4-(2,4,6-trimethylphenyl)but-2-en-2-olate (PubChem CID 23670626) has the molecular formula C13H12F3NaO2 and a molecular weight of 280.22 g/mol. Its IUPAC name is sodium (Z)-1,1,1-trifluoro-4-oxo-4-(2,4,6-trimethylphenyl)but-2-en-2-olate.
| Compound Name | sodium (Z)-1,1,1-trifluoro-4-oxo-4-(2,4,6-trimethylphenyl)but-2-en-2-olate |
|---|---|
| PubChem CID | 23670626 |
| Molecular Formula | C13H12F3NaO2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | sodium (Z)-1,1,1-trifluoro-4-oxo-4-(2,4,6-trimethylphenyl)but-2-en-2-olate |
| SMILES | Cc1cc(C)c(C(=O)/C=C(\[O-])C(F)(F)F)c(C)c1.[Na+] |
| InChI | InChI=1S/C13H13F3O2.Na/c1-7-4-8(2)12(9(3)5-7)10(17)6-11(18)13(14,15)16;/h4-6,18H,1-3H3;/q;+1/p-1/b11-6-; |
| InChIKey | WOVHJPWHTTVISL-AVHZNCSWSA-M |
| XLogP | -0.39 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|