About sodium;dibenzofuran-4-sulfonate;hydrate
sodium;dibenzofuran-4-sulfonate;hydrate (PubChem CID 23670751) has the molecular formula C12H9NaO5S
and a molecular weight of 288.26 g/mol. Its IUPAC name is sodium;dibenzofuran-4-sulfonate;hydrate.
Molecular Properties
| Compound Name | sodium;dibenzofuran-4-sulfonate;hydrate |
| PubChem CID | 23670751 |
| Molecular Formula | C12H9NaO5S |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | sodium;dibenzofuran-4-sulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])c1cccc2c1oc1ccccc12.[Na+] |
| InChI | InChI=1S/C12H8O4S.Na.H2O/c13-17(14,15)11-7-3-5-9-8-4-1-2-6-10(8)16-12(9)11;;/h1-7H,(H,13,14,15);;1H2/q;+1;/p-1 |
| InChIKey | CILRABBSLUFGGM-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;dibenzofuran-4-sulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dibenzofuran-4-sulfonate;hydrate?
The IUPAC name of sodium;dibenzofuran-4-sulfonate;hydrate (CID 23670751) is sodium;dibenzofuran-4-sulfonate;hydrate.
What is the SMILES notation for sodium;dibenzofuran-4-sulfonate;hydrate?
The canonical SMILES for sodium;dibenzofuran-4-sulfonate;hydrate is O.O=S(=O)([O-])c1cccc2c1oc1ccccc12.[Na+].
What is the InChIKey of sodium;dibenzofuran-4-sulfonate;hydrate?
The InChIKey is CILRABBSLUFGGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H8O4S.Na.H2O/c13-17(14,15)11-7-3-5-9-8-4-1-2-6-10(8)16-12(9)11;;/h1-7H,(H,13,14,15);;1H2/q;+1;/p-1.
What are the key properties of sodium;dibenzofuran-4-sulfonate;hydrate?
sodium;dibenzofuran-4-sulfonate;hydrate has a molecular weight of 288.26 g/mol, XLogP of -1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dibenzofuran-4-sulfonate;hydrate is sourced from PubChem (CID 23670751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).