About benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate
benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate (PubChem CID 2367131) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
| PubChem CID | 2367131 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
| SMILES | O=C1CN(C(=O)OCc2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C16H14N2O3/c19-15-10-18(14-9-5-4-8-13(14)17-15)16(20)21-11-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,17,19) |
| InChIKey | XIJVGCYRIIUFKS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate?
The IUPAC name of benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate (CID 2367131) is benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate.
What is the SMILES notation for benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate?
The canonical SMILES for benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate is O=C1CN(C(=O)OCc2ccccc2)c2ccccc2N1.
What is the InChIKey of benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate?
The InChIKey is XIJVGCYRIIUFKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c19-15-10-18(14-9-5-4-8-13(14)17-15)16(20)21-11-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,17,19).
What are the key properties of benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate?
benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate has a molecular weight of 282.30 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate is sourced from PubChem (CID 2367131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).