About sodium 4-decylbenzenesulfonate
sodium 4-decylbenzenesulfonate (PubChem CID 23671430) has the molecular formula C16H25NaO3S
and a molecular weight of 320.43 g/mol. Its IUPAC name is sodium 4-decylbenzenesulfonate.
Molecular Properties
| Compound Name | sodium 4-decylbenzenesulfonate |
| PubChem CID | 23671430 |
| Molecular Formula | C16H25NaO3S |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | sodium 4-decylbenzenesulfonate |
| SMILES | CCCCCCCCCCc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C16H26O3S.Na/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19;/h11-14H,2-10H2,1H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | RLJSXMVTLMHXJS-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-decylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-decylbenzenesulfonate?
The IUPAC name of sodium 4-decylbenzenesulfonate (CID 23671430) is sodium 4-decylbenzenesulfonate.
What is the SMILES notation for sodium 4-decylbenzenesulfonate?
The canonical SMILES for sodium 4-decylbenzenesulfonate is CCCCCCCCCCc1ccc(S(=O)(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-decylbenzenesulfonate?
The InChIKey is RLJSXMVTLMHXJS-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H26O3S.Na/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19;/h11-14H,2-10H2,1H3,(H,17,18,19);/q;+1/p-1.
What are the key properties of sodium 4-decylbenzenesulfonate?
sodium 4-decylbenzenesulfonate has a molecular weight of 320.43 g/mol, XLogP of 1.28, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-decylbenzenesulfonate is sourced from PubChem (CID 23671430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).