C26H48KNO9S — CID 23671831
potassium [(2R,3R,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxan-4-yl] sulfate (PubChem CID 23671831) has the molecular formula C26H48KNO9S and a molecular weight of 589.83 g/mol. Its IUPAC name is potassium [(2R,3R,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxan-4-yl] sulfate.
| Compound Name | potassium [(2R,3R,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxan-4-yl] sulfate |
|---|---|
| PubChem CID | 23671831 |
| Molecular Formula | C26H48KNO9S |
| Molecular Weight | 589.83 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | potassium [(2R,3R,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxan-4-yl] sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OS(=O)(=O)[O-])[C@H]1NC(C)=O.[K+] |
| InChI | InChI=1S/C26H49NO9S.K/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-34-26-23(27-21(2)29)25(36-37(31,32)33)24(30)22(20-28)35-26;/h10-11,22-26,28,30H,3-9,12-20H2,1-2H3,(H,27,29)(H,31,32,33);/q;+1/p-1/b11-10-;/t22-,23-,24-,25-,26+;/m1./s1 |
| InChIKey | NKYFFGXXSGSENJ-DHMKWOKMSA-M |
| XLogP | 0.47 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.83 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|