C19H26KNO9S — CID 23671838
potassium [(2R,3R,4R,5R,6S)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-enoylamino)-6-(2-phenylethoxy)oxan-4-yl] sulfate (PubChem CID 23671838) has the molecular formula C19H26KNO9S and a molecular weight of 483.58 g/mol. Its IUPAC name is potassium [(2R,3R,4R,5R,6S)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-enoylamino)-6-(2-phenylethoxy)oxan-4-yl] sulfate.
| Compound Name | potassium [(2R,3R,4R,5R,6S)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-enoylamino)-6-(2-phenylethoxy)oxan-4-yl] sulfate |
|---|---|
| PubChem CID | 23671838 |
| Molecular Formula | C19H26KNO9S |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | potassium [(2R,3R,4R,5R,6S)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-enoylamino)-6-(2-phenylethoxy)oxan-4-yl] sulfate |
| SMILES | C=CCCC(=O)N[C@H]1[C@@H](OCCc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1OS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C19H27NO9S.K/c1-2-3-9-15(22)20-16-18(29-30(24,25)26)17(23)14(12-21)28-19(16)27-11-10-13-7-5-4-6-8-13;/h2,4-8,14,16-19,21,23H,1,3,9-12H2,(H,20,22)(H,24,25,26);/q;+1/p-1/t14-,16-,17-,18-,19+;/m1./s1 |
| InChIKey | JSVJTWKWOOQGEX-QPDYWXRMSA-M |
| XLogP | -3.38 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|