C27H35N2NaO8S3 — CID 23672286
sodium 4-[3-acetylsulfanyl-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate (PubChem CID 23672286) has the molecular formula C27H35N2NaO8S3 and a molecular weight of 634.77 g/mol. Its IUPAC name is sodium 4-[3-acetylsulfanyl-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate.
| Compound Name | sodium 4-[3-acetylsulfanyl-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate |
|---|---|
| PubChem CID | 23672286 |
| Molecular Formula | C27H35N2NaO8S3 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | sodium 4-[3-acetylsulfanyl-8-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-8-oxooctyl]sulfanyl-4-oxobutanoate |
| SMILES | CC(=O)SC(CCCCC(=O)N(C)CCOc1ccc(CC2SC(=O)NC2=O)cc1)CCSC(=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C27H36N2O8S3.Na/c1-18(30)39-21(13-16-38-25(34)12-11-24(32)33)5-3-4-6-23(31)29(2)14-15-37-20-9-7-19(8-10-20)17-22-26(35)28-27(36)40-22;/h7-10,21-22H,3-6,11-17H2,1-2H3,(H,32,33)(H,28,35,36);/q;+1/p-1 |
| InChIKey | FXCQVHCJHQWBOK-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|