sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate

C6H11NaO7 — CID 23672301

IUPACsodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate
SMILESO=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+]
InChIInChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1
InChIKeyUPMFZISCCZSDND-JJKGCWMISA-M
MW218.14 g/mol
LogP-7.82
Rot. Bonds5

About sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate

sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 23672301) has the molecular formula C6H11NaO7 and a molecular weight of 218.14 g/mol. Its IUPAC name is sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.

Molecular Properties

Compound Namesodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate
PubChem CID23672301
Molecular FormulaC6H11NaO7
Molecular Weight218.14 g/mol
Exact Mass218.04
IUPAC Namesodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate
SMILESO=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+]
InChIInChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1
InChIKeyUPMFZISCCZSDND-JJKGCWMISA-M
XLogP-7.82
TPSA141.28 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.14
LogP ≤ 5-7.82
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Analyze sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate?
The IUPAC name of sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (CID 23672301) is sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
What is the SMILES notation for sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate?
The canonical SMILES for sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate is O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+].
What is the InChIKey of sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate?
The InChIKey is UPMFZISCCZSDND-JJKGCWMISA-M. The full InChI is InChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1.
What are the key properties of sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate?
sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate has a molecular weight of 218.14 g/mol, XLogP of -7.82, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate is sourced from PubChem (CID 23672301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).