C6H11NaO7 — CID 23672301
sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 23672301) has the molecular formula C6H11NaO7 and a molecular weight of 218.14 g/mol. Its IUPAC name is sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 23672301 |
| Molecular Formula | C6H11NaO7 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | UPMFZISCCZSDND-JJKGCWMISA-M |
| XLogP | -7.82 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | -7.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |