sodium 2,6-ditert-butylnaphthalene-1-sulfonate

C18H23NaO3S — CID 23672302

IUPACsodium 2,6-ditert-butylnaphthalene-1-sulfonate
SMILESCC(C)(C)c1ccc2c(S(=O)(=O)[O-])c(C(C)(C)C)ccc2c1.[Na+]
InChIInChI=1S/C18H24O3S.Na/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21;/h7-11H,1-6H3,(H,19,20,21);/q;+1/p-1
InChIKeyXYEXKDCAGSHWSD-UHFFFAOYSA-M
MW342.44 g/mol
LogP1.34
Rot. Bonds1

About sodium 2,6-ditert-butylnaphthalene-1-sulfonate

sodium 2,6-ditert-butylnaphthalene-1-sulfonate (PubChem CID 23672302) has the molecular formula C18H23NaO3S and a molecular weight of 342.44 g/mol. Its IUPAC name is sodium 2,6-ditert-butylnaphthalene-1-sulfonate.

Molecular Properties

Compound Namesodium 2,6-ditert-butylnaphthalene-1-sulfonate
PubChem CID23672302
Molecular FormulaC18H23NaO3S
Molecular Weight342.44 g/mol
Exact Mass342.13
IUPAC Namesodium 2,6-ditert-butylnaphthalene-1-sulfonate
SMILESCC(C)(C)c1ccc2c(S(=O)(=O)[O-])c(C(C)(C)C)ccc2c1.[Na+]
InChIInChI=1S/C18H24O3S.Na/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21;/h7-11H,1-6H3,(H,19,20,21);/q;+1/p-1
InChIKeyXYEXKDCAGSHWSD-UHFFFAOYSA-M
XLogP1.34
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.44
LogP ≤ 51.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 2,6-ditert-butylnaphthalene-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2,6-ditert-butylnaphthalene-1-sulfonate?
The IUPAC name of sodium 2,6-ditert-butylnaphthalene-1-sulfonate (CID 23672302) is sodium 2,6-ditert-butylnaphthalene-1-sulfonate.
What is the SMILES notation for sodium 2,6-ditert-butylnaphthalene-1-sulfonate?
The canonical SMILES for sodium 2,6-ditert-butylnaphthalene-1-sulfonate is CC(C)(C)c1ccc2c(S(=O)(=O)[O-])c(C(C)(C)C)ccc2c1.[Na+].
What is the InChIKey of sodium 2,6-ditert-butylnaphthalene-1-sulfonate?
The InChIKey is XYEXKDCAGSHWSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H24O3S.Na/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21;/h7-11H,1-6H3,(H,19,20,21);/q;+1/p-1.
What are the key properties of sodium 2,6-ditert-butylnaphthalene-1-sulfonate?
sodium 2,6-ditert-butylnaphthalene-1-sulfonate has a molecular weight of 342.44 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2,6-ditert-butylnaphthalene-1-sulfonate is sourced from PubChem (CID 23672302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).