About sodium 2,3-dihydroxypropyl hydrogen phosphate
sodium 2,3-dihydroxypropyl hydrogen phosphate (PubChem CID 23672316) has the molecular formula C3H8NaO6P
and a molecular weight of 194.05 g/mol. Its IUPAC name is sodium 2,3-dihydroxypropyl hydrogen phosphate.
Molecular Properties
| Compound Name | sodium 2,3-dihydroxypropyl hydrogen phosphate |
| PubChem CID | 23672316 |
| Molecular Formula | C3H8NaO6P |
| Molecular Weight | 194.05 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | sodium 2,3-dihydroxypropyl hydrogen phosphate |
| SMILES | O=P([O-])(O)OCC(O)CO.[Na+] |
| InChI | InChI=1S/C3H9O6P.Na/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+1/p-1 |
| InChIKey | REULQIKBNNDNDX-UHFFFAOYSA-M |
| XLogP | -5.18 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.05 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium 2,3-dihydroxypropyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2,3-dihydroxypropyl hydrogen phosphate?
The IUPAC name of sodium 2,3-dihydroxypropyl hydrogen phosphate (CID 23672316) is sodium 2,3-dihydroxypropyl hydrogen phosphate.
What is the SMILES notation for sodium 2,3-dihydroxypropyl hydrogen phosphate?
The canonical SMILES for sodium 2,3-dihydroxypropyl hydrogen phosphate is O=P([O-])(O)OCC(O)CO.[Na+].
What is the InChIKey of sodium 2,3-dihydroxypropyl hydrogen phosphate?
The InChIKey is REULQIKBNNDNDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9O6P.Na/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+1/p-1.
What are the key properties of sodium 2,3-dihydroxypropyl hydrogen phosphate?
sodium 2,3-dihydroxypropyl hydrogen phosphate has a molecular weight of 194.05 g/mol, XLogP of -5.18, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2,3-dihydroxypropyl hydrogen phosphate is sourced from PubChem (CID 23672316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).