C15H23LiN3O13P — CID 23672410
lithium [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 23672410) has the molecular formula C15H23LiN3O13P and a molecular weight of 491.27 g/mol. Its IUPAC name is lithium [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | lithium [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 23672410 |
| Molecular Formula | C15H23LiN3O13P |
| Molecular Weight | 491.27 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | lithium [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)([O-])O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)n1.[Li+] |
| InChI | InChI=1S/C15H24N3O13P.Li/c16-7-1-2-18(15(25)17-7)13-11(23)9(21)6(29-13)4-28-32(26,27)31-14-12(24)10(22)8(20)5(3-19)30-14;/h1-2,5-6,8-14,19-24H,3-4H2,(H,26,27)(H2,16,17,25);/q;+1/p-1/t5-,6-,8+,9-,10+,11-,12-,13-,14-;/m1./s1 |
| InChIKey | YMNSORGRNCOCGS-HRRBYNKCSA-M |
| XLogP | -8.25 |
| TPSA | 259.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.27 |
| LogP ≤ 5 | -8.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|