C22H29N2NaO5 — CID 23672439
sodium 6-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]hexanoate (PubChem CID 23672439) has the molecular formula C22H29N2NaO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is sodium 6-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]hexanoate.
| Compound Name | sodium 6-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]hexanoate |
|---|---|
| PubChem CID | 23672439 |
| Molecular Formula | C22H29N2NaO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | sodium 6-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]hexanoate |
| SMILES | COc1ccc(C2=NN(CCCCCC(=O)[O-])C(=O)C3CCCCC23)cc1OC.[Na+] |
| InChI | InChI=1S/C22H30N2O5.Na/c1-28-18-12-11-15(14-19(18)29-2)21-16-8-5-6-9-17(16)22(27)24(23-21)13-7-3-4-10-20(25)26;/h11-12,14,16-17H,3-10,13H2,1-2H3,(H,25,26);/q;+1/p-1 |
| InChIKey | XSZPCTDFVSXOEG-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|