About sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate
sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 23672769) has the molecular formula C17H12NNaO3S
and a molecular weight of 333.34 g/mol. Its IUPAC name is sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate |
| PubChem CID | 23672769 |
| Molecular Formula | C17H12NNaO3S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(-c2cccc(Oc3ccccc3)c2)n1.[Na+] |
| InChI | InChI=1S/C17H13NO3S.Na/c19-16(20)10-13-11-22-17(18-13)12-5-4-8-15(9-12)21-14-6-2-1-3-7-14;/h1-9,11H,10H2,(H,19,20);/q;+1/p-1 |
| InChIKey | HOKQEQWPZCJPGM-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate?
The IUPAC name of sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate (CID 23672769) is sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate is O=C([O-])Cc1csc(-c2cccc(Oc3ccccc3)c2)n1.[Na+].
What is the InChIKey of sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate?
The InChIKey is HOKQEQWPZCJPGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H13NO3S.Na/c19-16(20)10-13-11-22-17(18-13)12-5-4-8-15(9-12)21-14-6-2-1-3-7-14;/h1-9,11H,10H2,(H,19,20);/q;+1/p-1.
What are the key properties of sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate?
sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate has a molecular weight of 333.34 g/mol, XLogP of -0.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 23672769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).