C22H19N2NaO7S — CID 23672999
sodium (2S,3R,5R,6Z)-3-methyl-4,4,7-trioxo-3-[(2-phenylacetyl)oxymethyl]-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23672999) has the molecular formula C22H19N2NaO7S and a molecular weight of 478.46 g/mol. Its IUPAC name is sodium (2S,3R,5R,6Z)-3-methyl-4,4,7-trioxo-3-[(2-phenylacetyl)oxymethyl]-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,3R,5R,6Z)-3-methyl-4,4,7-trioxo-3-[(2-phenylacetyl)oxymethyl]-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23672999 |
| Molecular Formula | C22H19N2NaO7S |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | sodium (2S,3R,5R,6Z)-3-methyl-4,4,7-trioxo-3-[(2-phenylacetyl)oxymethyl]-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(COC(=O)Cc2ccccc2)[C@H](C(=O)[O-])N2C(=O)/C(=C/c3ccccn3)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C22H20N2O7S.Na/c1-22(13-31-17(25)11-14-7-3-2-4-8-14)18(21(27)28)24-19(26)16(20(24)32(22,29)30)12-15-9-5-6-10-23-15;/h2-10,12,18,20H,11,13H2,1H3,(H,27,28);/q;+1/p-1/b16-12-;/t18-,20+,22-;/m0./s1 |
| InChIKey | MUJKFWBRSHGIHW-UCHZMLBPSA-M |
| XLogP | -3.27 |
| TPSA | 133.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|