C18H22KN2O7PS — CID 23673259
potassium 3-[[(5S)-2-dimethoxyphosphoryl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate (PubChem CID 23673259) has the molecular formula C18H22KN2O7PS and a molecular weight of 480.52 g/mol. Its IUPAC name is potassium 3-[[(5S)-2-dimethoxyphosphoryl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate.
| Compound Name | potassium 3-[[(5S)-2-dimethoxyphosphoryl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 23673259 |
| Molecular Formula | C18H22KN2O7PS |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | potassium 3-[[(5S)-2-dimethoxyphosphoryl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate |
| SMILES | COP(=O)(OC)C1N2C(=O)C(NC(=O)C(C(=O)[O-])c3ccccc3)[C@@H]2SC1(C)C.[K+] |
| InChI | InChI=1S/C18H23N2O7PS.K/c1-18(2)17(28(25,26-3)27-4)20-14(22)12(15(20)29-18)19-13(21)11(16(23)24)10-8-6-5-7-9-10;/h5-9,11-12,15,17H,1-4H3,(H,19,21)(H,23,24);/q;+1/p-1/t11?,12?,15-,17?;/m0./s1 |
| InChIKey | TYXHGHOQKNFXNR-UCMWTAMLSA-M |
| XLogP | -2.49 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|