C12H11N2NaO6S — CID 23673329
sodium (2S,3S,5R)-3-methyl-3-[(Z)-2-(1,2-oxazol-5-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23673329) has the molecular formula C12H11N2NaO6S and a molecular weight of 334.29 g/mol. Its IUPAC name is sodium (2S,3S,5R)-3-methyl-3-[(Z)-2-(1,2-oxazol-5-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,3S,5R)-3-methyl-3-[(Z)-2-(1,2-oxazol-5-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23673329 |
| Molecular Formula | C12H11N2NaO6S |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | sodium (2S,3S,5R)-3-methyl-3-[(Z)-2-(1,2-oxazol-5-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(/C=C\c2ccno2)[C@H](C(=O)[O-])N2C(=O)C[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C12H12N2O6S.Na/c1-12(4-2-7-3-5-13-20-7)10(11(16)17)14-8(15)6-9(14)21(12,18)19;/h2-5,9-10H,6H2,1H3,(H,16,17);/q;+1/p-1/b4-2-;/t9-,10+,12+;/m1./s1 |
| InChIKey | CSOVPODSTUALAV-GNQMVHMPSA-M |
| XLogP | -4.44 |
| TPSA | 120.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |