C33H28N3NaO7S — CID 23673671
sodium 3-[4-[[9,10-dioxo-4-(propan-2-ylamino)anthracen-1-yl]amino]phenoxy]-2-[(prop-2-enoylamino)methyl]benzenesulfonate (PubChem CID 23673671) has the molecular formula C33H28N3NaO7S and a molecular weight of 633.66 g/mol. Its IUPAC name is sodium 3-[4-[[9,10-dioxo-4-(propan-2-ylamino)anthracen-1-yl]amino]phenoxy]-2-[(prop-2-enoylamino)methyl]benzenesulfonate.
| Compound Name | sodium 3-[4-[[9,10-dioxo-4-(propan-2-ylamino)anthracen-1-yl]amino]phenoxy]-2-[(prop-2-enoylamino)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 23673671 |
| Molecular Formula | C33H28N3NaO7S |
| Molecular Weight | 633.66 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | sodium 3-[4-[[9,10-dioxo-4-(propan-2-ylamino)anthracen-1-yl]amino]phenoxy]-2-[(prop-2-enoylamino)methyl]benzenesulfonate |
| SMILES | C=CC(=O)NCc1c(Oc2ccc(Nc3ccc(NC(C)C)c4c3C(=O)c3ccccc3C4=O)cc2)cccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C33H29N3O7S.Na/c1-4-29(37)34-18-24-27(10-7-11-28(24)44(40,41)42)43-21-14-12-20(13-15-21)36-26-17-16-25(35-19(2)3)30-31(26)33(39)23-9-6-5-8-22(23)32(30)38;/h4-17,19,35-36H,1,18H2,2-3H3,(H,34,37)(H,40,41,42);/q;+1/p-1 |
| InChIKey | DNBJZAWNRWELJB-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|