About sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate
sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 23673837) has the molecular formula C20H37NaO7S
and a molecular weight of 444.57 g/mol. Its IUPAC name is sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate.
Molecular Properties
| Compound Name | sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
| PubChem CID | 23673837 |
| Molecular Formula | C20H37NaO7S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H38O7S.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);/q;+1/p-1 |
| InChIKey | APSBXTVYXVQYAB-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate?
The IUPAC name of sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate (CID 23673837) is sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate.
What is the SMILES notation for sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate?
The canonical SMILES for sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate is CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate?
The InChIKey is APSBXTVYXVQYAB-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H38O7S.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);/q;+1/p-1.
What are the key properties of sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate?
sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate has a molecular weight of 444.57 g/mol, XLogP of 0.81, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate is sourced from PubChem (CID 23673837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).