About sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate
sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate (PubChem CID 23674493) has the molecular formula C10H15NaO4
and a molecular weight of 222.22 g/mol. Its IUPAC name is sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate |
| PubChem CID | 23674493 |
| Molecular Formula | C10H15NaO4 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate |
| SMILES | CC1(C(=O)[O-])CCC(C(=O)O)C1(C)C.[Na+] |
| InChI | InChI=1S/C10H16O4.Na/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14;/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14);/q;+1/p-1 |
| InChIKey | LHEJHRZSOXHWDV-UHFFFAOYSA-M |
| XLogP | -2.73 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate?
The IUPAC name of sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate (CID 23674493) is sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate.
What is the SMILES notation for sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate?
The canonical SMILES for sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate is CC1(C(=O)[O-])CCC(C(=O)O)C1(C)C.[Na+].
What is the InChIKey of sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate?
The InChIKey is LHEJHRZSOXHWDV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16O4.Na/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14;/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14);/q;+1/p-1.
What are the key properties of sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate?
sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate has a molecular weight of 222.22 g/mol, XLogP of -2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-carboxy-1,2,2-trimethylcyclopentane-1-carboxylate is sourced from PubChem (CID 23674493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).