C20H7Cl4NaO5 — CID 23674722
sodium 4,5,6,7-tetrachloro-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate (PubChem CID 23674722) has the molecular formula C20H7Cl4NaO5 and a molecular weight of 492.07 g/mol. Its IUPAC name is sodium 4,5,6,7-tetrachloro-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate.
| Compound Name | sodium 4,5,6,7-tetrachloro-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate |
|---|---|
| PubChem CID | 23674722 |
| Molecular Formula | C20H7Cl4NaO5 |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 489.89 |
| IUPAC Name | sodium 4,5,6,7-tetrachloro-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate |
| SMILES | O=C1OC2(c3ccc([O-])cc3Oc3cc(O)ccc32)c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[Na+] |
| InChI | InChI=1S/C20H8Cl4O5.Na/c21-15-13-14(16(22)18(24)17(15)23)20(29-19(13)27)9-3-1-7(25)5-11(9)28-12-6-8(26)2-4-10(12)20;/h1-6,25-26H;/q;+1/p-1 |
| InChIKey | QWNSGMNGFVECKH-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|