C24H31LiO — CID 23674791
lithium 3,3-dimethyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-olate (PubChem CID 23674791) has the molecular formula C24H31LiO and a molecular weight of 342.45 g/mol. Its IUPAC name is lithium 3,3-dimethyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-olate.
| Compound Name | lithium 3,3-dimethyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-olate |
|---|---|
| PubChem CID | 23674791 |
| Molecular Formula | C24H31LiO |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | lithium 3,3-dimethyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-olate |
| SMILES | Cc1cc(C)c(C(=C([O-])C(C)(C)C)c2c(C)cc(C)cc2C)c(C)c1.[Li+] |
| InChI | InChI=1S/C24H32O.Li/c1-14-10-16(3)20(17(4)11-14)22(23(25)24(7,8)9)21-18(5)12-15(2)13-19(21)6;/h10-13,25H,1-9H3;/q;+1/p-1 |
| InChIKey | YPMANQDOLMOMQO-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|