About lithium;2-methylpropanamide;chloride
lithium;2-methylpropanamide;chloride (PubChem CID 23674959) has the molecular formula C4H9ClLiNO
and a molecular weight of 129.52 g/mol. Its IUPAC name is lithium;2-methylpropanamide;chloride.
Molecular Properties
| Compound Name | lithium;2-methylpropanamide;chloride |
| PubChem CID | 23674959 |
| Molecular Formula | C4H9ClLiNO |
| Molecular Weight | 129.52 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | lithium;2-methylpropanamide;chloride |
| SMILES | CC(C)C(N)=O.[Cl-].[Li+] |
| InChI | InChI=1S/C4H9NO.ClH.Li/c1-3(2)4(5)6;;/h3H,1-2H3,(H2,5,6);1H;/q;;+1/p-1 |
| InChIKey | ICXWPWNCVZCKEG-UHFFFAOYSA-M |
| XLogP | -5.86 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.52 |
| LogP ≤ 5 | -5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;2-methylpropanamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-methylpropanamide;chloride?
The IUPAC name of lithium;2-methylpropanamide;chloride (CID 23674959) is lithium;2-methylpropanamide;chloride.
What is the SMILES notation for lithium;2-methylpropanamide;chloride?
The canonical SMILES for lithium;2-methylpropanamide;chloride is CC(C)C(N)=O.[Cl-].[Li+].
What is the InChIKey of lithium;2-methylpropanamide;chloride?
The InChIKey is ICXWPWNCVZCKEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.ClH.Li/c1-3(2)4(5)6;;/h3H,1-2H3,(H2,5,6);1H;/q;;+1/p-1.
What are the key properties of lithium;2-methylpropanamide;chloride?
lithium;2-methylpropanamide;chloride has a molecular weight of 129.52 g/mol, XLogP of -5.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-methylpropanamide;chloride is sourced from PubChem (CID 23674959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).