About potassium 3,7-dimethyloctan-3-olate
potassium 3,7-dimethyloctan-3-olate (PubChem CID 23675099) has the molecular formula C10H21KO
and a molecular weight of 196.37 g/mol. Its IUPAC name is potassium 3,7-dimethyloctan-3-olate.
Molecular Properties
| Compound Name | potassium 3,7-dimethyloctan-3-olate |
| PubChem CID | 23675099 |
| Molecular Formula | C10H21KO |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | potassium 3,7-dimethyloctan-3-olate |
| SMILES | CCC(C)([O-])CCCC(C)C.[K+] |
| InChI | InChI=1S/C10H21O.K/c1-5-10(4,11)8-6-7-9(2)3;/h9H,5-8H2,1-4H3;/q-1;+1 |
| InChIKey | RGTULLOKMOQGAQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium 3,7-dimethyloctan-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3,7-dimethyloctan-3-olate?
The IUPAC name of potassium 3,7-dimethyloctan-3-olate (CID 23675099) is potassium 3,7-dimethyloctan-3-olate.
What is the SMILES notation for potassium 3,7-dimethyloctan-3-olate?
The canonical SMILES for potassium 3,7-dimethyloctan-3-olate is CCC(C)([O-])CCCC(C)C.[K+].
What is the InChIKey of potassium 3,7-dimethyloctan-3-olate?
The InChIKey is RGTULLOKMOQGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O.K/c1-5-10(4,11)8-6-7-9(2)3;/h9H,5-8H2,1-4H3;/q-1;+1.
What are the key properties of potassium 3,7-dimethyloctan-3-olate?
potassium 3,7-dimethyloctan-3-olate has a molecular weight of 196.37 g/mol, XLogP of -0.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3,7-dimethyloctan-3-olate is sourced from PubChem (CID 23675099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).