C20H17NaO3S — CID 23675463
sodium 2-oxo-3-(3-oxo-1-phenylpentyl)thiochromen-4-olate (PubChem CID 23675463) has the molecular formula C20H17NaO3S and a molecular weight of 360.41 g/mol. Its IUPAC name is sodium 2-oxo-3-(3-oxo-1-phenylpentyl)thiochromen-4-olate.
| Compound Name | sodium 2-oxo-3-(3-oxo-1-phenylpentyl)thiochromen-4-olate |
|---|---|
| PubChem CID | 23675463 |
| Molecular Formula | C20H17NaO3S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | sodium 2-oxo-3-(3-oxo-1-phenylpentyl)thiochromen-4-olate |
| SMILES | CCC(=O)CC(c1ccccc1)c1c([O-])c2ccccc2sc1=O.[Na+] |
| InChI | InChI=1S/C20H18O3S.Na/c1-2-14(21)12-16(13-8-4-3-5-9-13)18-19(22)15-10-6-7-11-17(15)24-20(18)23;/h3-11,16,22H,2,12H2,1H3;/q;+1/p-1 |
| InChIKey | GBNIQWPKIUIMDZ-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |