About sodium 2-phenylphenolate
sodium 2-phenylphenolate (PubChem CID 23675735) has the molecular formula C12H9NaO
and a molecular weight of 192.19 g/mol. Its IUPAC name is sodium 2-phenylphenolate.
Molecular Properties
| Compound Name | sodium 2-phenylphenolate |
| PubChem CID | 23675735 |
| Molecular Formula | C12H9NaO |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | sodium 2-phenylphenolate |
| SMILES | [Na+].[O-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1/p-1 |
| InChIKey | KSQXVLVXUFHGJQ-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium 2-phenylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-phenylphenolate?
The IUPAC name of sodium 2-phenylphenolate (CID 23675735) is sodium 2-phenylphenolate.
What is the SMILES notation for sodium 2-phenylphenolate?
The canonical SMILES for sodium 2-phenylphenolate is [Na+].[O-]c1ccccc1-c1ccccc1.
What is the InChIKey of sodium 2-phenylphenolate?
The InChIKey is KSQXVLVXUFHGJQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1/p-1.
What are the key properties of sodium 2-phenylphenolate?
sodium 2-phenylphenolate has a molecular weight of 192.19 g/mol, XLogP of -0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-phenylphenolate is sourced from PubChem (CID 23675735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).