C7H5ClN3NaO4S2 — CID 23675744
sodium 6-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-ide-7-sulfonamide (PubChem CID 23675744) has the molecular formula C7H5ClN3NaO4S2 and a molecular weight of 317.71 g/mol. Its IUPAC name is sodium 6-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-ide-7-sulfonamide.
| Compound Name | sodium 6-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-ide-7-sulfonamide |
|---|---|
| PubChem CID | 23675744 |
| Molecular Formula | C7H5ClN3NaO4S2 |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | sodium 6-chloro-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-ide-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)N=C[N-]S2(=O)=O.[Na+] |
| InChI | InChI=1S/C7H5ClN3O4S2.Na/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5;/h1-3H,(H2-,9,10,11,12,13);/q-1;+1 |
| InChIKey | CPIWHAFLBZQYLQ-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |