C19H18Cl2N3NaO6S — CID 23675786
Dicloxacillin sodium monohydrate (PubChem CID 23675786) has the molecular formula C19H18Cl2N3NaO6S and a molecular weight of 510.30 g/mol. Its IUPAC name is sodium;(2S,5R,6R)-6-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;hydrate.
| Compound Name | Dicloxacillin sodium monohydrate |
|---|---|
| PubChem CID | 23675786 |
| Molecular Formula | C19H18Cl2N3NaO6S |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | sodium;(2S,5R,6R)-6-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;hydrate |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-].O.[Na+] |
| InChI | InChI=1S/C19H17Cl2N3O5S.Na.H2O/c1-7-10(12(23-29-7)11-8(20)5-4-6-9(11)21)15(25)22-13-16(26)24-14(18(27)28)19(2,3)30-17(13)24;;/h4-6,13-14,17H,1-3H3,(H,22,25)(H,27,28);;1H2/q;+1;/p-1/t13-,14+,17-;;/m1../s1 |
| InChIKey | SIGZQNJITOWQEF-VICXVTCVSA-M |
| XLogP | — |
| TPSA | 142.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | 752 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |