About potassium 4-methylphenolate
potassium 4-methylphenolate (PubChem CID 23676568) has the molecular formula C7H7KO
and a molecular weight of 146.23 g/mol. Its IUPAC name is potassium 4-methylphenolate.
Molecular Properties
| Compound Name | potassium 4-methylphenolate |
| PubChem CID | 23676568 |
| Molecular Formula | C7H7KO |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | potassium 4-methylphenolate |
| SMILES | Cc1ccc([O-])cc1.[K+] |
| InChI | InChI=1S/C7H8O.K/c1-6-2-4-7(8)5-3-6;/h2-5,8H,1H3;/q;+1/p-1 |
| InChIKey | RRAHCFJFWDVGGZ-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium 4-methylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 4-methylphenolate?
The IUPAC name of potassium 4-methylphenolate (CID 23676568) is potassium 4-methylphenolate.
What is the SMILES notation for potassium 4-methylphenolate?
The canonical SMILES for potassium 4-methylphenolate is Cc1ccc([O-])cc1.[K+].
What is the InChIKey of potassium 4-methylphenolate?
The InChIKey is RRAHCFJFWDVGGZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O.K/c1-6-2-4-7(8)5-3-6;/h2-5,8H,1H3;/q;+1/p-1.
What are the key properties of potassium 4-methylphenolate?
potassium 4-methylphenolate has a molecular weight of 146.23 g/mol, XLogP of -1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-methylphenolate is sourced from PubChem (CID 23676568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).