sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate

C5H2FN2NaO4 — CID 23676657

IUPACsodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate
SMILESO=C([O-])c1[nH]c(=O)[nH]c(=O)c1F.[Na+]
InChIInChI=1S/C5H3FN2O4.Na/c6-1-2(4(10)11)7-5(12)8-3(1)9;/h(H,10,11)(H2,7,8,9,12);/q;+1/p-1
InChIKeyZLXIAMGSEDWSQY-UHFFFAOYSA-M
MW196.07 g/mol
LogP-5.43
Rot. Bonds1

About sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate

sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 23676657) has the molecular formula C5H2FN2NaO4 and a molecular weight of 196.07 g/mol. Its IUPAC name is sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate.

Molecular Properties

Compound Namesodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate
PubChem CID23676657
Molecular FormulaC5H2FN2NaO4
Molecular Weight196.07 g/mol
Exact Mass195.99
IUPAC Namesodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate
SMILESO=C([O-])c1[nH]c(=O)[nH]c(=O)c1F.[Na+]
InChIInChI=1S/C5H3FN2O4.Na/c6-1-2(4(10)11)7-5(12)8-3(1)9;/h(H,10,11)(H2,7,8,9,12);/q;+1/p-1
InChIKeyZLXIAMGSEDWSQY-UHFFFAOYSA-M
XLogP-5.43
TPSA105.85 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.07
LogP ≤ 5-5.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The IUPAC name of sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate (CID 23676657) is sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate.
What is the SMILES notation for sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The canonical SMILES for sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate is O=C([O-])c1[nH]c(=O)[nH]c(=O)c1F.[Na+].
What is the InChIKey of sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The InChIKey is ZLXIAMGSEDWSQY-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H3FN2O4.Na/c6-1-2(4(10)11)7-5(12)8-3(1)9;/h(H,10,11)(H2,7,8,9,12);/q;+1/p-1.
What are the key properties of sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate?
sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate has a molecular weight of 196.07 g/mol, XLogP of -5.43, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylate is sourced from PubChem (CID 23676657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).